C18H19AsN2O5 — CID 174385918
(4-acetamido-2-hydroxyphenyl)arsonic acid;3-cyclopropylbenzonitrile (PubChem CID 174385918) has the molecular formula C18H19AsN2O5 and a molecular weight of 418.28 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;3-cyclopropylbenzonitrile.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-cyclopropylbenzonitrile |
|---|---|
| PubChem CID | 174385918 |
| Molecular Formula | C18H19AsN2O5 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-cyclopropylbenzonitrile |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.N#Cc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C10H9N.C8H10AsNO5/c11-7-8-2-1-3-10(6-8)9-4-5-9;1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15/h1-3,6,9H,4-5H2;2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | KWVIRANNHWARSM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|