C15H17AsN2O7 — CID 157071067
(4-acetamido-2-hydroxyphenyl)arsonic acid;1-methyl-3-nitrobenzene (PubChem CID 157071067) has the molecular formula C15H17AsN2O7 and a molecular weight of 412.23 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;1-methyl-3-nitrobenzene.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;1-methyl-3-nitrobenzene |
|---|---|
| PubChem CID | 157071067 |
| Molecular Formula | C15H17AsN2O7 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;1-methyl-3-nitrobenzene |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H10AsNO5.C7H7NO2/c1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15;1-6-3-2-4-7(5-6)8(9)10/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);2-5H,1H3 |
| InChIKey | ACKYZYXTGORBAT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|