C12H14AsN3O5 — CID 174391050
(5-acetamido-2-hydroxyphenyl)arsonic acid;pyrimidine (PubChem CID 174391050) has the molecular formula C12H14AsN3O5 and a molecular weight of 355.18 g/mol. Its IUPAC name is (5-acetamido-2-hydroxyphenyl)arsonic acid;pyrimidine.
| Compound Name | (5-acetamido-2-hydroxyphenyl)arsonic acid;pyrimidine |
|---|---|
| PubChem CID | 174391050 |
| Molecular Formula | C12H14AsN3O5 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | (5-acetamido-2-hydroxyphenyl)arsonic acid;pyrimidine |
| SMILES | CC(=O)Nc1ccc(O)c([As](=O)(O)O)c1.c1cncnc1 |
| InChI | InChI=1S/C8H10AsNO5.C4H4N2/c1-5(11)10-6-2-3-8(12)7(4-6)9(13,14)15;1-2-5-4-6-3-1/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);1-4H |
| InChIKey | DJDYKVXHEHXBQL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|