About (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene
(4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene (PubChem CID 174301348) has the molecular formula C20H19AsN2O7
and a molecular weight of 474.30 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene.
Molecular Properties
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene |
| PubChem CID | 174301348 |
| Molecular Formula | C20H19AsN2O7 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=[N+]([O-])c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H9NO2.C8H10AsNO5/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-9H;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | WDVUSJXXCOBRRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene?
The IUPAC name of (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene (CID 174301348) is (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene.
What is the SMILES notation for (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene?
The canonical SMILES for (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene is CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=[N+]([O-])c1cccc(-c2ccccc2)c1.
What is the InChIKey of (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene?
The InChIKey is WDVUSJXXCOBRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2.C8H10AsNO5/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-9H;2-5,14H,1H3,(H,10,11)(H,12,13).
What are the key properties of (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene?
(4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene has a molecular weight of 474.30 g/mol, XLogP of 2.97, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl)-hydroperoxyarsinic acid;1-nitro-3-phenylbenzene is sourced from PubChem (CID 174301348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).