C16H20AsNO5 — CID 174705794
(3-acetamidophenyl)-hydroperoxyarsinic acid;ethylbenzene (PubChem CID 174705794) has the molecular formula C16H20AsNO5 and a molecular weight of 381.26 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;ethylbenzene.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;ethylbenzene |
|---|---|
| PubChem CID | 174705794 |
| Molecular Formula | C16H20AsNO5 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;ethylbenzene |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.CCc1ccccc1 |
| InChI | InChI=1S/C8H10AsNO5.C8H10/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14;1-2-8-6-4-3-5-7-8/h2-5,14H,1H3,(H,10,11)(H,12,13);3-7H,2H2,1H3 |
| InChIKey | FLCYXHRLEWFZPA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|