C12H15AsN4O7 — CID 174495207
(3-acetamidophenyl)-hydroperoxyarsinic acid;6-amino-1H-pyrimidine-2,4-dione (PubChem CID 174495207) has the molecular formula C12H15AsN4O7 and a molecular weight of 402.20 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;6-amino-1H-pyrimidine-2,4-dione.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;6-amino-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174495207 |
| Molecular Formula | C12H15AsN4O7 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;6-amino-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H10AsNO5.C4H5N3O2/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14;5-2-1-3(8)7-4(9)6-2/h2-5,14H,1H3,(H,10,11)(H,12,13);1H,(H4,5,6,7,8,9) |
| InChIKey | ZRYWXDSBMPNDNI-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 187.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|