C15H17AsFNO5 — CID 174756554
(3-acetamidophenyl)-hydroperoxyarsinic acid;1-fluoro-3-methylbenzene (PubChem CID 174756554) has the molecular formula C15H17AsFNO5 and a molecular weight of 385.22 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;1-fluoro-3-methylbenzene.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;1-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 174756554 |
| Molecular Formula | C15H17AsFNO5 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;1-fluoro-3-methylbenzene |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C8H10AsNO5.C7H7F/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14;1-6-3-2-4-7(8)5-6/h2-5,14H,1H3,(H,10,11)(H,12,13);2-5H,1H3 |
| InChIKey | HVIYXLCJKWZVSN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|