C8H9AsBrNO5 — CID 175320469
[(3-acetamidophenyl)-hydroperoxyarsoryl] hypobromite (PubChem CID 175320469) has the molecular formula C8H9AsBrNO5 and a molecular weight of 353.99 g/mol. Its IUPAC name is [(3-acetamidophenyl)-hydroperoxyarsoryl] hypobromite.
| Compound Name | [(3-acetamidophenyl)-hydroperoxyarsoryl] hypobromite |
|---|---|
| PubChem CID | 175320469 |
| Molecular Formula | C8H9AsBrNO5 |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 352.89 |
| IUPAC Name | [(3-acetamidophenyl)-hydroperoxyarsoryl] hypobromite |
| SMILES | CC(=O)Nc1cccc([As](=O)(OO)OBr)c1 |
| InChI | InChI=1S/C8H9AsBrNO5/c1-6(12)11-8-4-2-3-7(5-8)9(13,15-10)16-14/h2-5,14H,1H3,(H,11,12) |
| InChIKey | KPOXIDQFYNKDPK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|