C18H20AsNO9 — CID 174384601
(3-acetamidophenyl)-hydroperoxyarsinic acid;methyl 4-acetyloxybenzoate (PubChem CID 174384601) has the molecular formula C18H20AsNO9 and a molecular weight of 469.28 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;methyl 4-acetyloxybenzoate.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;methyl 4-acetyloxybenzoate |
|---|---|
| PubChem CID | 174384601 |
| Molecular Formula | C18H20AsNO9 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;methyl 4-acetyloxybenzoate |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.COC(=O)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C10H10O4.C8H10AsNO5/c1-7(11)14-9-5-3-8(4-6-9)10(12)13-2;1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14/h3-6H,1-2H3;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | XADODTLRTIHHEF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|