C17H23AsN2O5 — CID 174696638
(3-acetamidophenyl)-hydroperoxyarsinic acid;2,4,6-trimethylaniline (PubChem CID 174696638) has the molecular formula C17H23AsN2O5 and a molecular weight of 410.30 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;2,4,6-trimethylaniline.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 174696638 |
| Molecular Formula | C17H23AsN2O5 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;2,4,6-trimethylaniline |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C9H13N.C8H10AsNO5/c1-6-4-7(2)9(10)8(3)5-6;1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14/h4-5H,10H2,1-3H3;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | AVIGUUMXNVWFCN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|