C17H26AsNO7 — CID 174918413
(3-acetamidophenyl)-hydroperoxyarsinic acid;ethyl 4,4-dimethylpent-2-enoate (PubChem CID 174918413) has the molecular formula C17H26AsNO7 and a molecular weight of 431.32 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;ethyl 4,4-dimethylpent-2-enoate.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;ethyl 4,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 174918413 |
| Molecular Formula | C17H26AsNO7 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;ethyl 4,4-dimethylpent-2-enoate |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.CCOC(=O)C=CC(C)(C)C |
| InChI | InChI=1S/C9H16O2.C8H10AsNO5/c1-5-11-8(10)6-7-9(2,3)4;1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14/h6-7H,5H2,1-4H3;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | ONVYGTWFBFTKIK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|