C18H22AsN3O7 — CID 174249619
(3-acetamidophenyl)-hydroperoxyarsinic acid;1-(4-nitrophenyl)pyrrolidine (PubChem CID 174249619) has the molecular formula C18H22AsN3O7 and a molecular weight of 467.31 g/mol. Its IUPAC name is (3-acetamidophenyl)-hydroperoxyarsinic acid;1-(4-nitrophenyl)pyrrolidine.
| Compound Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;1-(4-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 174249619 |
| Molecular Formula | C18H22AsN3O7 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | (3-acetamidophenyl)-hydroperoxyarsinic acid;1-(4-nitrophenyl)pyrrolidine |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)OO)c1.O=[N+]([O-])c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C10H12N2O2.C8H10AsNO5/c13-12(14)10-5-3-9(4-6-10)11-7-1-2-8-11;1-6(11)10-8-4-2-3-7(5-8)9(12,13)15-14/h3-6H,1-2,7-8H2;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | UMCJBTUFTXYTNQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|