C11H14AsNO7S — CID 174390256
[(3-acetamidophenyl)-hydroperoxyarsoryl] prop-2-ene-1-sulfonate (PubChem CID 174390256) has the molecular formula C11H14AsNO7S and a molecular weight of 379.22 g/mol. Its IUPAC name is [(3-acetamidophenyl)-hydroperoxyarsoryl] prop-2-ene-1-sulfonate.
| Compound Name | [(3-acetamidophenyl)-hydroperoxyarsoryl] prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 174390256 |
| Molecular Formula | C11H14AsNO7S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | [(3-acetamidophenyl)-hydroperoxyarsoryl] prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)O[As](=O)(OO)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C11H14AsNO7S/c1-3-7-21(17,18)20-12(15,19-16)10-5-4-6-11(8-10)13-9(2)14/h3-6,8,16H,1,7H2,2H3,(H,13,14) |
| InChIKey | YKJXYZSMPHGXME-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|