C8H11AsN2O5 — CID 174408278
N-[3-[aminooxy(hydroperoxy)arsoryl]phenyl]acetamide (PubChem CID 174408278) has the molecular formula C8H11AsN2O5 and a molecular weight of 290.11 g/mol. Its IUPAC name is N-[3-[aminooxy(hydroperoxy)arsoryl]phenyl]acetamide.
| Compound Name | N-[3-[aminooxy(hydroperoxy)arsoryl]phenyl]acetamide |
|---|---|
| PubChem CID | 174408278 |
| Molecular Formula | C8H11AsN2O5 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | N-[3-[aminooxy(hydroperoxy)arsoryl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([As](=O)(ON)OO)c1 |
| InChI | InChI=1S/C8H11AsN2O5/c1-6(12)11-8-4-2-3-7(5-8)9(13,15-10)16-14/h2-5,14H,10H2,1H3,(H,11,12) |
| InChIKey | NDWCTTSXGVKAHA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|