C16H18AsNO7 — CID 174468016
(4-acetamidophenyl)-hydroperoxyarsinic acid;2-phenylacetic acid (PubChem CID 174468016) has the molecular formula C16H18AsNO7 and a molecular weight of 411.24 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;2-phenylacetic acid.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;2-phenylacetic acid |
|---|---|
| PubChem CID | 174468016 |
| Molecular Formula | C16H18AsNO7 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;2-phenylacetic acid |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H10AsNO5.C8H8O2/c1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14;9-8(10)6-7-4-2-1-3-5-7/h2-5,14H,1H3,(H,10,11)(H,12,13);1-5H,6H2,(H,9,10) |
| InChIKey | SWYZHOQQZWBVOT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|