C21H22AsN3O6 — CID 174259115
(4-acetamidophenyl)-hydroperoxyarsinic acid;N-(2-aminophenyl)benzamide (PubChem CID 174259115) has the molecular formula C21H22AsN3O6 and a molecular weight of 487.34 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;N-(2-aminophenyl)benzamide.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 174259115 |
| Molecular Formula | C21H22AsN3O6 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;N-(2-aminophenyl)benzamide |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.Nc1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O.C8H10AsNO5/c14-11-8-4-5-9-12(11)15-13(16)10-6-2-1-3-7-10;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-9H,14H2,(H,15,16);2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | IHDSBFLJLUPUFB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|