C24H23AsN4O6S — CID 174510255
(4-acetamidophenyl)-hydroperoxyarsinic acid;N-[2-amino-5-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 174510255) has the molecular formula C24H23AsN4O6S and a molecular weight of 570.46 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;N-[2-amino-5-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;N-[2-amino-5-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 174510255 |
| Molecular Formula | C24H23AsN4O6S |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;N-[2-amino-5-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.Nc1ccc(-c2nccs2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N3OS.C8H10AsNO5/c17-13-7-6-12(16-18-8-9-21-16)10-14(13)19-15(20)11-4-2-1-3-5-11;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-10H,17H2,(H,19,20);2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | MOYXANVYHMNZBK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|