C16H19AsN4O7 — CID 174647991
(4-acetamidophenyl)-hydroperoxyarsinic acid;3-(hydrazinylmethylideneamino)benzoic acid (PubChem CID 174647991) has the molecular formula C16H19AsN4O7 and a molecular weight of 454.27 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;3-(hydrazinylmethylideneamino)benzoic acid.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;3-(hydrazinylmethylideneamino)benzoic acid |
|---|---|
| PubChem CID | 174647991 |
| Molecular Formula | C16H19AsN4O7 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;3-(hydrazinylmethylideneamino)benzoic acid |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.NN/C=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H10AsNO5.C8H9N3O2/c1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14;9-11-5-10-7-3-1-2-6(4-7)8(12)13/h2-5,14H,1H3,(H,10,11)(H,12,13);1-5H,9H2,(H,10,11)(H,12,13) |
| InChIKey | HYGLWIKCEHDQES-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 183.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|