C11H16AsNO9S2 — CID 174747737
(4-acetamidophenyl)-hydroperoxyarsinic acid;1,3-dithiolane 1,1,3,3-tetraoxide (PubChem CID 174747737) has the molecular formula C11H16AsNO9S2 and a molecular weight of 445.30 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;1,3-dithiolane 1,1,3,3-tetraoxide.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;1,3-dithiolane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 174747737 |
| Molecular Formula | C11H16AsNO9S2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;1,3-dithiolane 1,1,3,3-tetraoxide |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=S1(=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H10AsNO5.C3H6O4S2/c1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14;4-8(5)1-2-9(6,7)3-8/h2-5,14H,1H3,(H,10,11)(H,12,13);1-3H2 |
| InChIKey | ZIPIMNRLVMSEPN-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|