C15H15AsCl2N2O7 — CID 174778198
(4-acetamidophenyl)-hydroperoxyarsinic acid;methyl 3,6-dichloropyridine-2-carboxylate (PubChem CID 174778198) has the molecular formula C15H15AsCl2N2O7 and a molecular weight of 481.12 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;methyl 3,6-dichloropyridine-2-carboxylate.
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;methyl 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 174778198 |
| Molecular Formula | C15H15AsCl2N2O7 |
| Molecular Weight | 481.12 g/mol |
| Exact Mass | 479.95 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;methyl 3,6-dichloropyridine-2-carboxylate |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.COC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H10AsNO5.C7H5Cl2NO2/c1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14;1-12-7(11)6-4(8)2-3-5(9)10-6/h2-5,14H,1H3,(H,10,11)(H,12,13);2-3H,1H3 |
| InChIKey | JDBXEMWESCQIEJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|