C19H11Cl3N2O3 — CID 26645827
[4-[(2-chlorobenzoyl)amino]phenyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 26645827) has the molecular formula C19H11Cl3N2O3 and a molecular weight of 421.67 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)amino]phenyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 26645827 |
| Molecular Formula | C19H11Cl3N2O3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)c2nc(Cl)ccc2Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H11Cl3N2O3/c20-14-4-2-1-3-13(14)18(25)23-11-5-7-12(8-6-11)27-19(26)17-15(21)9-10-16(22)24-17/h1-10H,(H,23,25) |
| InChIKey | FTRWVRMSRFGJBM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|