About [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate
[4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate (PubChem CID 26682865) has the molecular formula C22H18ClNO4
and a molecular weight of 395.84 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate.
Molecular Properties
| Compound Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate |
| PubChem CID | 26682865 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate |
| SMILES | O=C(CCOc1ccccc1)Oc1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO4/c23-20-9-5-4-8-19(20)22(26)24-16-10-12-18(13-11-16)28-21(25)14-15-27-17-6-2-1-3-7-17/h1-13H,14-15H2,(H,24,26) |
| InChIKey | FELADLWTOJVYGC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate?
The IUPAC name of [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate (CID 26682865) is [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate.
What is the SMILES notation for [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate?
The canonical SMILES for [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate is O=C(CCOc1ccccc1)Oc1ccc(NC(=O)c2ccccc2Cl)cc1.
What is the InChIKey of [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate?
The InChIKey is FELADLWTOJVYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClNO4/c23-20-9-5-4-8-19(20)22(26)24-16-10-12-18(13-11-16)28-21(25)14-15-27-17-6-2-1-3-7-17/h1-13H,14-15H2,(H,24,26).
What are the key properties of [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate?
[4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate has a molecular weight of 395.84 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-chlorobenzoyl)amino]phenyl] 3-phenoxypropanoate is sourced from PubChem (CID 26682865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).