C24H22ClNO4 — CID 26683269
[4-[(2-chlorobenzoyl)amino]phenyl] 4-(3-methylphenoxy)butanoate (PubChem CID 26683269) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)amino]phenyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [4-[(2-chlorobenzoyl)amino]phenyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 26683269 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [4-[(2-chlorobenzoyl)amino]phenyl] 4-(3-methylphenoxy)butanoate |
| SMILES | Cc1cccc(OCCCC(=O)Oc2ccc(NC(=O)c3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C24H22ClNO4/c1-17-6-4-7-20(16-17)29-15-5-10-23(27)30-19-13-11-18(12-14-19)26-24(28)21-8-2-3-9-22(21)25/h2-4,6-9,11-14,16H,5,10,15H2,1H3,(H,26,28) |
| InChIKey | GBVIKLRCAWKPHL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|