C24H18ClN3O4 — CID 137299587
[4-[(2-chlorobenzoyl)amino]phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 137299587) has the molecular formula C24H18ClN3O4 and a molecular weight of 447.88 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)amino]phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 137299587 |
| Molecular Formula | C24H18ClN3O4 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-[(2-chlorobenzoyl)amino]phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)Oc1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H18ClN3O4/c25-19-7-3-1-5-17(19)23(30)26-15-9-11-16(12-10-15)32-22(29)14-13-21-27-20-8-4-2-6-18(20)24(31)28-21/h1-12H,13-14H2,(H,26,30)(H,27,28,31) |
| InChIKey | IJXDXEFXVKGNEB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|