C18H14N2O5 — CID 135809794
1,3-benzodioxol-5-yl 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135809794) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135809794 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O5/c21-17(25-11-5-6-14-15(9-11)24-10-23-14)8-7-16-19-13-4-2-1-3-12(13)18(22)20-16/h1-6,9H,7-8,10H2,(H,19,20,22) |
| InChIKey | SGSIAFPEWNDIMP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|