C21H19N3O4 — CID 137306620
[4-(2-oxopyrrolidin-1-yl)phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 137306620) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 137306620 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4/c25-19-6-3-13-24(19)14-7-9-15(10-8-14)28-20(26)12-11-18-22-17-5-2-1-4-16(17)21(27)23-18/h1-2,4-5,7-10H,3,6,11-13H2,(H,22,23,27) |
| InChIKey | VNLDMTPHTADDRU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|