C15H14N2O5 — CID 135831841
[(3R)-2-oxooxolan-3-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135831841) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135831841 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)O[C@@H]1CCOC1=O |
| InChI | InChI=1S/C15H14N2O5/c18-13(22-11-7-8-21-15(11)20)6-5-12-16-10-4-2-1-3-9(10)14(19)17-12/h1-4,11H,5-8H2,(H,16,17,19)/t11-/m1/s1 |
| InChIKey | PKVTXFGQZCJPBD-LLVKDONJSA-N |
| XLogP | 0.71 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |