C17H20N2O4 — CID 137300052
oxolan-2-ylmethyl 4-(4-oxo-3H-quinazolin-2-yl)butanoate (PubChem CID 137300052) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-(4-oxo-3H-quinazolin-2-yl)butanoate.
| Compound Name | oxolan-2-ylmethyl 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
|---|---|
| PubChem CID | 137300052 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | oxolan-2-ylmethyl 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
| SMILES | O=C(CCCc1nc2ccccc2c(=O)[nH]1)OCC1CCCO1 |
| InChI | InChI=1S/C17H20N2O4/c20-16(23-11-12-5-4-10-22-12)9-3-8-15-18-14-7-2-1-6-13(14)17(21)19-15/h1-2,6-7,12H,3-5,8-11H2,(H,18,19,21) |
| InChIKey | ZSWVBZOBYFQMCZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |