C22H23N3O4 — CID 135830344
N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-phenoxyacetamide (PubChem CID 135830344) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 135830344 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)N(Cc1nc2ccccc2c(=O)[nH]1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(15-29-16-7-2-1-3-8-16)25(13-17-9-6-12-28-17)14-20-23-19-11-5-4-10-18(19)22(27)24-20/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,23,24,27)/t17-/m1/s1 |
| InChIKey | SKDUPZJMSQJWKC-QGZVFWFLSA-N |
| XLogP | 2.51 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |