C21H20FN3O3 — CID 135722369
3-fluoro-N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135722369) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-fluoro-N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | 3-fluoro-N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135722369 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-fluoro-N-[[(2R)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | O=C(c1cccc(F)c1)N(Cc1nc2ccccc2c(=O)[nH]1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H20FN3O3/c22-15-6-3-5-14(11-15)21(27)25(12-16-7-4-10-28-16)13-19-23-18-9-2-1-8-17(18)20(26)24-19/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,23,24,26)/t16-/m1/s1 |
| InChIKey | WUCFHXWFOMNTLS-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |