C20H18Cl2N4O3 — CID 135920659
3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 135920659) has the molecular formula C20H18Cl2N4O3 and a molecular weight of 433.30 g/mol. Its IUPAC name is 3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135920659 |
| Molecular Formula | C20H18Cl2N4O3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 3,6-dichloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N(Cc1nc2ccccc2c(=O)[nH]1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H18Cl2N4O3/c21-14-7-8-16(22)24-18(14)20(28)26(10-12-4-3-9-29-12)11-17-23-15-6-2-1-5-13(15)19(27)25-17/h1-2,5-8,12H,3-4,9-11H2,(H,23,25,27)/t12-/m0/s1 |
| InChIKey | GGTRVVGAFFFGAT-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|