C22H22ClN3O4 — CID 135891120
2-(4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide (PubChem CID 135891120) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 135891120 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N(Cc1nc2ccccc2c(=O)[nH]1)CC1CCCO1 |
| InChI | InChI=1S/C22H22ClN3O4/c23-15-7-9-16(10-8-15)30-14-21(27)26(12-17-4-3-11-29-17)13-20-24-19-6-2-1-5-18(19)22(28)25-20/h1-2,5-10,17H,3-4,11-14H2,(H,24,25,28) |
| InChIKey | XMKBZTIQBFIABE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |