C19H24AsNO7 — CID 174652510
(3-acetamido-2-hydroxyphenyl)arsonic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;ethyl propanoate (PubChem CID 174652510) has the molecular formula C19H24AsNO7 and a molecular weight of 453.32 g/mol. Its IUPAC name is (3-acetamido-2-hydroxyphenyl)arsonic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;ethyl propanoate.
| Compound Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;ethyl propanoate |
|---|---|
| PubChem CID | 174652510 |
| Molecular Formula | C19H24AsNO7 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;ethyl propanoate |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)O)c1O.CCOC(=O)CC.c1cc2cc-2c1 |
| InChI | InChI=1S/C8H10AsNO5.C6H4.C5H10O2/c1-5(11)10-7-4-2-3-6(8(7)12)9(13,14)15;1-2-5-4-6(5)3-1;1-3-5(6)7-4-2/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);1-4H;3-4H2,1-2H3 |
| InChIKey | AAASXKWRMKSAES-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|