C11H12O3 — CID 174579142
acetyl propanoate;bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 174579142) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is acetyl propanoate;bicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | acetyl propanoate;bicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 174579142 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | acetyl propanoate;bicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CCC(=O)OC(C)=O.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C5H8O3/c1-2-5-4-6(5)3-1;1-3-5(7)8-4(2)6/h1-4H;3H2,1-2H3 |
| InChIKey | PKMZLZAGPGKLEG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|