C7H8O2 — CID 175364747
bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol (PubChem CID 175364747) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol |
|---|---|
| PubChem CID | 175364747 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol |
| SMILES | OCO.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.CH4O2/c1-2-5-4-6(5)3-1;2-1-3/h1-4H;2-3H,1H2 |
| InChIKey | PVTPEEFLWRAVIJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|