About bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol
bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol (PubChem CID 175364747) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol |
| PubChem CID | 175364747 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol |
| SMILES | OCO.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.CH4O2/c1-2-5-4-6(5)3-1;2-1-3/h1-4H;2-3H,1H2 |
| InChIKey | PVTPEEFLWRAVIJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol (CID 175364747) is bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol is OCO.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol?
The InChIKey is PVTPEEFLWRAVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.CH4O2/c1-2-5-4-6(5)3-1;2-1-3/h1-4H;2-3H,1H2.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol?
bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol has a molecular weight of 124.14 g/mol, XLogP of 0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;methanediol is sourced from PubChem (CID 175364747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).