C6H4ClI — CID 174404159
CID 174404159 (PubChem CID 174404159) has the molecular formula C6H4ClI and a molecular weight of 238.46 g/mol.
| Compound Name | CID 174404159 |
|---|---|
| PubChem CID | 174404159 |
| Molecular Formula | C6H4ClI |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | — |
| SMILES | ClI.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.ClI/c1-2-5-4-6(5)3-1;1-2/h1-4H; |
| InChIKey | AJVVGQZAWHOFMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|