About CID 174404159
CID 174404159 (PubChem CID 174404159) has the molecular formula C6H4ClI
and a molecular weight of 238.46 g/mol.
Molecular Properties
| Compound Name | CID 174404159 |
| PubChem CID | 174404159 |
| Molecular Formula | C6H4ClI |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | — |
| SMILES | ClI.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.ClI/c1-2-5-4-6(5)3-1;1-2/h1-4H; |
| InChIKey | AJVVGQZAWHOFMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 174404159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174404159?
The IUPAC name of CID 174404159 (CID 174404159) is not available.
What is the SMILES notation for CID 174404159?
The canonical SMILES for CID 174404159 is ClI.c1cc2cc-2c1.
What is the InChIKey of CID 174404159?
The InChIKey is AJVVGQZAWHOFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.ClI/c1-2-5-4-6(5)3-1;1-2/h1-4H;.
What are the key properties of CID 174404159?
CID 174404159 has a molecular weight of 238.46 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174404159 is sourced from PubChem (CID 174404159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).