About bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide
bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide (PubChem CID 174338176) has the molecular formula C6H5I
and a molecular weight of 204.01 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide |
| PubChem CID | 174338176 |
| Molecular Formula | C6H5I |
| Molecular Weight | 204.01 g/mol |
| Exact Mass | 203.94 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide |
| SMILES | I.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.HI/c1-2-5-4-6(5)3-1;/h1-4H;1H |
| InChIKey | CBTBULHTKSJDIM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.01 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide (CID 174338176) is bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide is I.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide?
The InChIKey is CBTBULHTKSJDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.HI/c1-2-5-4-6(5)3-1;/h1-4H;1H.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide?
bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide has a molecular weight of 204.01 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;hydroiodide is sourced from PubChem (CID 174338176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).