C9H12O — CID 174589601
bicyclo[3.1.0]hexa-1(6),2,4-triene;ethene;methanol (PubChem CID 174589601) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;ethene;methanol.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;ethene;methanol |
|---|---|
| PubChem CID | 174589601 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;ethene;methanol |
| SMILES | C=C.CO.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C2H4.CH4O/c1-2-5-4-6(5)3-1;2*1-2/h1-4H;1-2H2;2H,1H3 |
| InChIKey | CCKMEJIDUVFFCO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|