C42H22I8 — CID 118041830
1-[3-[3,5-bis(3,5-diiodophenyl)phenyl]phenyl]-3,5-bis(3,5-diiodophenyl)benzene (PubChem CID 118041830) has the molecular formula C42H22I8 and a molecular weight of 1541.87 g/mol. Its IUPAC name is 1-[3-[3,5-bis(3,5-diiodophenyl)phenyl]phenyl]-3,5-bis(3,5-diiodophenyl)benzene.
| Compound Name | 1-[3-[3,5-bis(3,5-diiodophenyl)phenyl]phenyl]-3,5-bis(3,5-diiodophenyl)benzene |
|---|---|
| PubChem CID | 118041830 |
| Molecular Formula | C42H22I8 |
| Molecular Weight | 1541.87 g/mol |
| Exact Mass | 1541.41 |
| IUPAC Name | 1-[3-[3,5-bis(3,5-diiodophenyl)phenyl]phenyl]-3,5-bis(3,5-diiodophenyl)benzene |
| SMILES | Ic1cc(I)cc(-c2cc(-c3cc(I)cc(I)c3)cc(-c3cccc(-c4cc(-c5cc(I)cc(I)c5)cc(-c5cc(I)cc(I)c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C42H22I8/c43-35-11-31(12-36(44)19-35)27-5-25(6-28(9-27)32-13-37(45)20-38(46)14-32)23-2-1-3-24(4-23)26-7-29(33-15-39(47)21-40(48)16-33)10-30(8-26)34-17-41(49)22-42(50)18-34/h1-22H |
| InChIKey | QEKMFZPIURILDV-UHFFFAOYSA-N |
| XLogP | 16.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1541.87 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|