About azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate
azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate (PubChem CID 175267221) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate.
Analyze azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate?
The IUPAC name of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate (CID 175267221) is azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate.
What is the SMILES notation for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate?
The canonical SMILES for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate is CCOC(=O)CC.N.c1cc2cc(c1)C2.
What is the InChIKey of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate?
The InChIKey is HCNMIOYNQHXFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.C5H10O2.H3N/c1-2-6-4-7(3-1)5-6;1-3-5(6)7-4-2;/h1-4H,5H2;3-4H2,1-2H3;1H3.
What are the key properties of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate?
azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate has a molecular weight of 209.29 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;ethyl propanoate is sourced from PubChem (CID 175267221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).