C21H37AsN2O7 — CID 174750488
(3-acetamido-2-hydroxyphenyl)arsonic acid;1-cyclobutyloctan-1-amine;formic acid (PubChem CID 174750488) has the molecular formula C21H37AsN2O7 and a molecular weight of 504.46 g/mol. Its IUPAC name is (3-acetamido-2-hydroxyphenyl)arsonic acid;1-cyclobutyloctan-1-amine;formic acid.
| Compound Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;1-cyclobutyloctan-1-amine;formic acid |
|---|---|
| PubChem CID | 174750488 |
| Molecular Formula | C21H37AsN2O7 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;1-cyclobutyloctan-1-amine;formic acid |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)O)c1O.CCCCCCCC(N)C1CCC1.O=CO |
| InChI | InChI=1S/C12H25N.C8H10AsNO5.CH2O2/c1-2-3-4-5-6-10-12(13)11-8-7-9-11;1-5(11)10-7-4-2-3-6(8(7)12)9(13,14)15;2-1-3/h11-12H,2-10,13H2,1H3;2-4,12H,1H3,(H,10,11)(H2,13,14,15);1H,(H,2,3) |
| InChIKey | HZDBWWAAOZWHPI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|