C20H21NO3 — CID 102374289
3-[(Z)-2-[3-(2,2-dimethylpropanoylamino)phenyl]ethenyl]benzoic acid (PubChem CID 102374289) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[(Z)-2-[3-(2,2-dimethylpropanoylamino)phenyl]ethenyl]benzoic acid.
| Compound Name | 3-[(Z)-2-[3-(2,2-dimethylpropanoylamino)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 102374289 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[(Z)-2-[3-(2,2-dimethylpropanoylamino)phenyl]ethenyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)Nc1cccc(/C=C\c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C20H21NO3/c1-20(2,3)19(24)21-17-9-5-7-15(13-17)11-10-14-6-4-8-16(12-14)18(22)23/h4-13H,1-3H3,(H,21,24)(H,22,23)/b11-10- |
| InChIKey | DKRLAGZOAIIDND-KHPPLWFESA-N |
| XLogP | 4.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|