C26H26AsN3O7S — CID 174554176
(4-acetamido-2-hydroxyphenyl)arsonic acid;ethyl 3-[(4-phenyl-1,3-thiazol-2-yl)amino]benzoate (PubChem CID 174554176) has the molecular formula C26H26AsN3O7S and a molecular weight of 599.50 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;ethyl 3-[(4-phenyl-1,3-thiazol-2-yl)amino]benzoate.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;ethyl 3-[(4-phenyl-1,3-thiazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 174554176 |
| Molecular Formula | C26H26AsN3O7S |
| Molecular Weight | 599.50 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;ethyl 3-[(4-phenyl-1,3-thiazol-2-yl)amino]benzoate |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.CCOC(=O)c1cccc(Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C18H16N2O2S.C8H10AsNO5/c1-2-22-17(21)14-9-6-10-15(11-14)19-18-20-16(12-23-18)13-7-4-3-5-8-13;1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15/h3-12H,2H2,1H3,(H,19,20);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | SXXDFCDEYNYKQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|