C17H14BrN3OS — CID 84564814
N-[3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide (PubChem CID 84564814) has the molecular formula C17H14BrN3OS and a molecular weight of 388.29 g/mol. Its IUPAC name is N-[3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 84564814 |
| Molecular Formula | C17H14BrN3OS |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | N-[3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nc(-c3ccc(Br)cc3)cs2)c1 |
| InChI | InChI=1S/C17H14BrN3OS/c1-11(22)19-14-3-2-4-15(9-14)20-17-21-16(10-23-17)12-5-7-13(18)8-6-12/h2-10H,1H3,(H,19,22)(H,20,21) |
| InChIKey | AHIVQSOMOLUSRB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |