C15H12BrN3O2S — CID 163174069
3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 163174069) has the molecular formula C15H12BrN3O2S and a molecular weight of 378.25 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163174069 |
| Molecular Formula | C15H12BrN3O2S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1cccc(Nc2nc(-c3ccc(Br)cc3)cs2)c1 |
| InChI | InChI=1S/C15H12BrN3O2S/c16-11-6-4-10(5-7-11)14-9-22-15(18-14)17-12-2-1-3-13(8-12)19(20)21/h1-9,19-20H,(H,17,18) |
| InChIKey | WNXOTCNYAWWEEY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|