C19H15N3O2S — CID 163137065
N-hydroxy-3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]benzeneamine oxide (PubChem CID 163137065) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-hydroxy-3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163137065 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-hydroxy-3-[2-(naphthalen-1-ylamino)-1,3-thiazol-4-yl]benzeneamine oxide |
| SMILES | [O-][NH+](O)c1cccc(-c2csc(Nc3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C19H15N3O2S/c23-22(24)15-8-3-7-14(11-15)18-12-25-19(21-18)20-17-10-4-6-13-5-1-2-9-16(13)17/h1-12,22-23H,(H,20,21) |
| InChIKey | IJDNLJKSMKRUSB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|