C13H14ClN5O4S — CID 21142785
3-[2-[(3-amino-2-carbamoyl-3-oxoprop-1-enyl)amino]-1,3-thiazol-4-yl]-N-hydroxybenzeneamine oxide;hydrochloride (PubChem CID 21142785) has the molecular formula C13H14ClN5O4S and a molecular weight of 371.81 g/mol. Its IUPAC name is 3-[2-[(3-amino-2-carbamoyl-3-oxoprop-1-enyl)amino]-1,3-thiazol-4-yl]-N-hydroxybenzeneamine oxide;hydrochloride.
| Compound Name | 3-[2-[(3-amino-2-carbamoyl-3-oxoprop-1-enyl)amino]-1,3-thiazol-4-yl]-N-hydroxybenzeneamine oxide;hydrochloride |
|---|---|
| PubChem CID | 21142785 |
| Molecular Formula | C13H14ClN5O4S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 3-[2-[(3-amino-2-carbamoyl-3-oxoprop-1-enyl)amino]-1,3-thiazol-4-yl]-N-hydroxybenzeneamine oxide;hydrochloride |
| SMILES | Cl.NC(=O)C(=CNc1nc(-c2cccc([NH+]([O-])O)c2)cs1)C(N)=O |
| InChI | InChI=1S/C13H13N5O4S.ClH/c14-11(19)9(12(15)20)5-16-13-17-10(6-23-13)7-2-1-3-8(4-7)18(21)22;/h1-6,18,21H,(H2,14,19)(H2,15,20)(H,16,17);1H |
| InChIKey | BAXXHFQNYFNWGU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 158.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|