C21H21N3O2S — CID 84565373
N-[3-[[4-[4-(2-methylprop-2-enoxy)phenyl]-1,3-thiazol-2-yl]amino]phenyl]acetamide (PubChem CID 84565373) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[3-[[4-[4-(2-methylprop-2-enoxy)phenyl]-1,3-thiazol-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[4-(2-methylprop-2-enoxy)phenyl]-1,3-thiazol-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 84565373 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-[[4-[4-(2-methylprop-2-enoxy)phenyl]-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| SMILES | C=C(C)COc1ccc(-c2csc(Nc3cccc(NC(C)=O)c3)n2)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14(2)12-26-19-9-7-16(8-10-19)20-13-27-21(24-20)23-18-6-4-5-17(11-18)22-15(3)25/h4-11,13H,1,12H2,2-3H3,(H,22,25)(H,23,24) |
| InChIKey | LHOMCGHEUKXBFZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|