C20H20N4O3S — CID 42764224
ethyl 2-[[3-(2-anilino-1,3-thiazol-4-yl)phenyl]carbamoylamino]acetate (PubChem CID 42764224) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl 2-[[3-(2-anilino-1,3-thiazol-4-yl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-(2-anilino-1,3-thiazol-4-yl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 42764224 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 2-[[3-(2-anilino-1,3-thiazol-4-yl)phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1cccc(-c2csc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-2-27-18(25)12-21-19(26)22-16-10-6-7-14(11-16)17-13-28-20(24-17)23-15-8-4-3-5-9-15/h3-11,13H,2,12H2,1H3,(H,23,24)(H2,21,22,26) |
| InChIKey | MWGBFRQOCFCKPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |