C16H19N3O3S — CID 164907004
ethyl 3-[[4-[3-(dimethylamino)phenyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate (PubChem CID 164907004) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 3-[[4-[3-(dimethylamino)phenyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[4-[3-(dimethylamino)phenyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 164907004 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethyl 3-[[4-[3-(dimethylamino)phenyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1nc(-c2cccc(N(C)C)c2)cs1 |
| InChI | InChI=1S/C16H19N3O3S/c1-4-22-15(21)9-14(20)18-16-17-13(10-23-16)11-6-5-7-12(8-11)19(2)3/h5-8,10H,4,9H2,1-3H3,(H,17,18,20) |
| InChIKey | PHBWNXMDCFXKTJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|